307531-79-9 Usage
Uses
Used in Organic Synthesis:
3,4-DIMETHOXYBENZYLZINC CHLORIDE is used as a nucleophilic reagent for transferring the 3,4-dimethoxybenzyl group to organic substrates, facilitating the formation of carbon-carbon bonds in various organic synthesis reactions.
Used in Pharmaceutical Industry:
3,4-DIMETHOXYBENZYLZINC CHLORIDE is used as a key reagent in the synthesis of pharmaceutical intermediates, contributing to the development of complex molecules with potential therapeutic applications.
Used in the Synthesis of Complex Molecules:
3,4-DIMETHOXYBENZYLZINC CHLORIDE is employed as a selective reagent in the synthesis of complex molecules, enabling the formation of specific carbon-carbon bonds and facilitating the creation of intricate molecular structures.
Check Digit Verification of cas no
The CAS Registry Mumber 307531-79-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,0,7,5,3 and 1 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 307531-79:
(8*3)+(7*0)+(6*7)+(5*5)+(4*3)+(3*1)+(2*7)+(1*9)=129
129 % 10 = 9
So 307531-79-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H11O2.ClH.Zn/c1-7-4-5-8(10-2)9(6-7)11-3;;/h4-6H,1H2,2-3H3;1H;/q;;+1/p-1/rC9H11O2Zn.ClH/c1-10-8-4-3-7(6-12)5-9(8)11-2;/h3-5H,6H2,1-2H3;1H/q+1;/p-1
