30823-52-0 Usage
Description
1-METHYL-4-PHENYL-5-AMINOPYRAZOLE, with the molecular formula C11H11N5, is a pyrazole derivative known for its potential medicinal properties. This chemical compound has been studied for its anti-inflammatory and analgesic effects, positioning it as a promising candidate for drug development. Its unique structure and properties also make it a valuable tool in organic chemistry research. However, further investigation is required to fully explore its potential applications and effects across various fields.
Uses
Used in Pharmaceutical Industry:
1-METHYL-4-PHENYL-5-AMINOPYRAZOLE is used as a pharmaceutical compound for its potential medicinal properties, particularly due to its anti-inflammatory and analgesic effects. It is being studied for its potential to alleviate pain and reduce inflammation, which could lead to the development of new drugs for treating various conditions.
Used in Organic Chemistry Research:
1-METHYL-4-PHENYL-5-AMINOPYRAZOLE is used as a research tool in the field of organic chemistry. Its unique structure and properties make it valuable for studying chemical reactions and mechanisms, contributing to the advancement of knowledge in this scientific domain.
While the provided materials do not specify different applications in various industries, the primary uses of 1-METHYL-4-PHENYL-5-AMINOPYRAZOLE are in the pharmaceutical industry for drug development and in organic chemistry research. Further research is necessary to explore additional applications and fully understand the compound's potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 30823-52-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,8,2 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 30823-52:
(7*3)+(6*0)+(5*8)+(4*2)+(3*3)+(2*5)+(1*2)=90
90 % 10 = 0
So 30823-52-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3/c1-13-10(11)9(7-12-13)8-5-3-2-4-6-8/h2-7H,11H2,1H3
30823-52-0Relevant articles and documents
ACLY INHIBITORS AND USES THEREOF
-
Paragraph 00770, (2020/06/01)
The present invention provides compounds useful as inhibitors of ATP citrate lyase (ACLY), compositions thereof, and methods of using the same.
