30953-60-7 Usage
Uses
Used in Pharmaceutical Industry:
1-(2,6-Dimethylphenethyl)hydrazine is used as a precursor in the synthesis of various drugs, contributing to the development of new medications and therapies. Its structural features make it a valuable building block in organic chemistry, facilitating the creation of diverse pharmaceutical compounds.
Used in Research:
In the realm of scientific research, 1-(2,6-Dimethylphenethyl)hydrazine serves as a reagent for the preparation of other chemical compounds. Its unique properties allow researchers to explore new avenues in chemical synthesis and potentially discover novel applications in various fields.
Used in Material Development:
The potential applications of 1-(2,6-Dimethylphenethyl)hydrazine extend to the development of new materials. Its structural characteristics and unique properties may contribute to the creation of innovative materials with specific properties tailored for various industries.
Used in Biological Studies:
1-(2,6-Dimethylphenethyl)hydrazine may also find use in biological studies, where its unique properties could be harnessed to investigate biological processes or develop new biologically active compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 30953-60-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,9,5 and 3 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 30953-60:
(7*3)+(6*0)+(5*9)+(4*5)+(3*3)+(2*6)+(1*0)=107
107 % 10 = 7
So 30953-60-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2/c1-8-4-3-5-9(2)10(8)6-7-12-11/h3-5,12H,6-7,11H2,1-2H3
