30984-80-6 Usage
General Description
Dauricinoline is a chemical compound that belongs to the class of benzoquinoline alkaloids. It is primarily found in the plant species Dicranostigma leptopodum, also known as Dauricum. Dauricinoline has attracted attention due to its potential therapeutic properties, particularly its anti-tumor and anti-inflammatory effects. Research has shown that dauricinoline has inhibitory effects on the growth of cancer cells, making it a promising candidate for the development of new anti-cancer drugs. Additionally, it has also demonstrated anti-inflammatory activities, suggesting its potential use in the treatment of inflammatory conditions. Further studies are needed to fully understand the pharmacological properties of dauricinoline and its potential applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 30984-80-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,0,9,8 and 4 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 30984-80:
(7*3)+(6*0)+(5*9)+(4*8)+(3*4)+(2*8)+(1*0)=126
126 % 10 = 6
So 30984-80-6 is a valid CAS Registry Number.
InChI:InChI=1/C37H42N2O6/c1-38-15-13-26-20-36(43-4)37(44-5)22-29(26)30(38)16-23-6-9-27(10-7-23)45-35-18-24(8-11-32(35)40)17-31-28-21-34(42-3)33(41)19-25(28)12-14-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1