31076-39-8 Usage
Uses
Used in Pharmaceutical Industry:
Cedeodarin is used as a pharmaceutical compound for its potential therapeutic applications. Its unique chemical structure, featuring multiple hydroxyl groups, allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Antioxidant Applications:
Cedeodarin is used as an antioxidant, leveraging its ability to neutralize free radicals and protect cells from oxidative damage. This property makes it a valuable ingredient in the development of nutraceuticals and cosmeceuticals, where it can contribute to the prevention of various diseases and the maintenance of healthy skin.
Used in Anti-Inflammatory Applications:
Due to its flavonoid nature, Cedeodarin is also used as an anti-inflammatory agent. It can help reduce inflammation and alleviate pain associated with various conditions, making it a potential candidate for inclusion in pharmaceutical formulations targeting inflammation-related disorders.
Used in Antimicrobial Applications:
Cedeodarin's ability to interact with biological targets also extends to its antimicrobial properties. It can be used as an antimicrobial agent, particularly against certain bacteria and fungi, making it a valuable component in the development of new antibiotics and antifungal medications.
Used in Drug Delivery Systems:
Similar to gallotannin, Cedeodarin can also be incorporated into drug delivery systems to enhance its bioavailability and therapeutic outcomes. By employing various carriers, such as organic and metallic nanoparticles, the delivery, efficacy, and targeting of Cedeodarin can be improved, leading to more effective treatments for various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 31076-39-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,0,7 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 31076-39:
(7*3)+(6*1)+(5*0)+(4*7)+(3*6)+(2*3)+(1*9)=88
88 % 10 = 8
So 31076-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H14O7/c1-6-9(18)5-11-12(13(6)20)14(21)15(22)16(23-11)7-2-3-8(17)10(19)4-7/h2-5,15-20,22H,1H3/t15-,16+/m0/s1
