31112-90-0 Usage
Uses
Used in Pharmaceutical Industry:
(2-Pyridin-3-yl-1,3-thiazol-4-yl)acetic acid is utilized as a pharmaceutical intermediate due to its potential biological activity and its role in the synthesis of various pharmaceuticals. Its presence in certain medications highlights its importance in drug development, where it contributes to the creation of effective treatments and therapies.
Used in Chemical Synthesis:
In the field of chemical synthesis, (2-Pyridin-3-yl-1,3-thiazol-4-yl)acetic acid serves as a key component in the production of other chemical compounds. Its structure and reactivity make it a versatile building block, allowing for the development of a wide range of chemical products with diverse applications.
Used in Medicinal Chemistry Research:
(2-Pyridin-3-yl-1,3-thiazol-4-yl)acetic acid is also employed in medicinal chemistry research as a subject of interest. Its unique structure and potential reactivity provide opportunities for exploring new avenues in drug development, leading to the discovery of novel therapeutic agents and advancing our understanding of molecular interactions in biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 31112-90-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,1,1 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 31112-90:
(7*3)+(6*1)+(5*1)+(4*1)+(3*2)+(2*9)+(1*0)=60
60 % 10 = 0
So 31112-90-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O2S/c13-9(14)4-8-6-15-10(12-8)7-2-1-3-11-5-7/h1-3,5-6H,4H2,(H,13,14)
