311346-69-7 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 4-CHLORO-5,7-DIFLUOROQUINOXALINE-3-CARBOXYLATE is used as a chemical intermediate for the development of pharmaceutical compounds. Its unique structure allows it to be a promising candidate for the synthesis of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Organic Synthesis:
In the field of organic synthesis, ETHYL 4-CHLORO-5,7-DIFLUOROQUINOXALINE-3-CARBOXYLATE serves as a key building block for the creation of more complex organic molecules. Its versatile structure can be further modified or used as a component in the synthesis of various organic compounds for different applications.
Further research and testing may be required to fully explore the potential uses and effects of ETHYL 4-CHLORO-5,7-DIFLUOROQUINOXALINE-3-CARBOXYLATE in these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 311346-69-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,1,3,4 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 311346-69:
(8*3)+(7*1)+(6*1)+(5*3)+(4*4)+(3*6)+(2*6)+(1*9)=107
107 % 10 = 7
So 311346-69-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H8ClF2NO2/c1-2-18-12(17)7-5-16-9-4-6(14)3-8(15)10(9)11(7)13/h3-5H,2H2,1H3
