312692-94-7 Usage
Uses
Used in Organic Synthesis:
2,3-DIMETHYLPHENYLZINC IODIDE is used as a reactive organozinc reagent for the incorporation of the 2,3-DIMETHYLPHENYLZINC functional group into various organic molecules. Its reactivity allows for the formation of new chemical bonds and the synthesis of complex organic compounds.
Used in Cross-Coupling Reactions:
In the field of organic chemistry, 2,3-DIMETHYLPHENYLZINC IODIDE is utilized as a key component in cross-coupling reactions, which are essential for creating carbon-carbon bonds. This application is crucial for the development of new organic molecules and the advancement of synthetic methodologies.
Used in the Creation of Complex Molecules:
2,3-DIMETHYLPHENYLZINC IODIDE is employed as a valuable tool in the synthesis of complex molecules, contributing to the advancement of pharmaceuticals, agrochemicals, and materials science. Its ability to participate in cross-coupling reactions facilitates the construction of intricate molecular structures with potential applications in various industries.
Used in Research and Development:
In academic and industrial research settings, 2,3-DIMETHYLPHENYLZINC IODIDE is used as a reagent to explore new reaction pathways, develop innovative synthetic methods, and understand the fundamental chemistry of organozinc compounds. Its unique properties make it an important compound for pushing the boundaries of chemical knowledge and application.
Check Digit Verification of cas no
The CAS Registry Mumber 312692-94-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,6,9 and 2 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 312692-94:
(8*3)+(7*1)+(6*2)+(5*6)+(4*9)+(3*2)+(2*9)+(1*4)=137
137 % 10 = 7
So 312692-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H9.HI.Zn/c1-7-5-3-4-6-8(7)2;;/h3-5H,1-2H3;1H;/q-1;;+2/p-1/rC8H9.IZn/c1-7-5-3-4-6-8(7)2;1-2/h3-5H,1-2H3;/q-1;+1
