312693-05-3 Usage
Uses
Used in Organic Synthesis:
2-Fluorobenzylzinc chloride is used as a reagent for the formation of carbon-carbon bonds in organic synthesis. Its nucleophilic nature allows it to participate in cross-coupling reactions, facilitating the creation of new carbon-carbon bonds and contributing to the synthesis of complex organic molecules.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2-Fluorobenzylzinc chloride is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its ability to form carbon-carbon bonds is essential for the construction of complex drug molecules, enhancing the development of new and effective medications.
Used in Material Science:
2-Fluorobenzylzinc chloride is also utilized in the development of new materials. Its unique properties and reactivity make it a valuable component in the synthesis of advanced materials with specific characteristics, such as improved strength, flexibility, or chemical resistance.
Used in Catalysis:
2-FLUOROBENZYLZINC CHLORIDE has been investigated for its potential use in catalysis, where it can act as a catalyst or a catalyst precursor to facilitate various chemical reactions. Its application in this field can lead to more efficient and selective processes in the synthesis of desired products.
Check Digit Verification of cas no
The CAS Registry Mumber 312693-05-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,6,9 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 312693-05:
(8*3)+(7*1)+(6*2)+(5*6)+(4*9)+(3*3)+(2*0)+(1*5)=123
123 % 10 = 3
So 312693-05-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F.ClH.Zn/c1-6-4-2-3-5-7(6)8;;/h2-5H,1H2;1H;/q;;+1/p-1/rC7H6ClFZn/c8-10-5-6-3-1-2-4-7(6)9/h1-4H,5H2
