312700-07-5 Usage
Uses
Used in Optoelectronic Devices:
9-(4-AMINOPHENYL)CARBAZOLE HYDROCHLORIDE is used as a key component in the synthesis of organic semiconductors for optoelectronic devices. Its role in creating organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs) is crucial due to its ability to enhance the performance and efficiency of these devices.
Used in Biochemical and Analytical Applications as a Fluorescent Dye:
In the field of biochemistry and analytical chemistry, 9-(4-AMINOPHENYL)CARBAZOLE HYDROCHLORIDE serves as a fluorescent dye. Its fluorescent properties allow it to be utilized in various applications, including the detection and analysis of biomolecules, offering a means to track and visualize specific biological processes or components.
Used in Materials Science:
9-(4-AMINOPHENYL)CARBAZOLE HYDROCHLORIDE has potential applications in materials science, where its unique structure and properties can contribute to the development of new materials with specific characteristics. Its use in this field can lead to advancements in areas such as nanotechnology, polymer science, and material engineering.
Used in Biochemistry:
Due to its chemical structure, 9-(4-AMINOPHENYL)CARBAZOLE HYDROCHLORIDE also has potential applications in biochemistry, where it can be employed in the study of enzyme mechanisms, protein interactions, and other biochemical processes. Its ability to act as a fluorescent probe can provide insights into the behavior of biological systems at the molecular level.
Check Digit Verification of cas no
The CAS Registry Mumber 312700-07-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,7,0 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 312700-07:
(8*3)+(7*1)+(6*2)+(5*7)+(4*0)+(3*0)+(2*0)+(1*7)=85
85 % 10 = 5
So 312700-07-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H14N2.ClH/c19-13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20;/h1-12H,19H2;1H
