312754-94-2 Usage
Uses
Used in Organic Synthesis:
(2-Allylsulfanyl-benzoimidazol-1-yl)-acetic acid is used as a reactive functional group in organic synthesis for the creation of various chemical compounds. Its allylthio group allows for versatile chemical reactions, making it a valuable component in the synthesis of new molecules.
Used in Pharmaceutical Development:
In the pharmaceutical industry, (2-Allylsulfanyl-benzoimidazol-1-yl)-acetic acid is utilized for its pharmacological properties, such as antimicrobial and antihelmintic activities. Its benzoimidazole structure contributes to these therapeutic effects, making it a promising candidate for the development of new drugs targeting infectious diseases and parasitic infections.
Used as a Carboxylic Acid Linker:
(2-Allylsulfanyl-benzoimidazol-1-yl)-acetic acid is employed as a carboxylic acid linker in organic synthesis, facilitating the formation of complex molecular structures. Its ability to connect different chemical entities makes it a valuable tool in the synthesis of advanced materials and pharmaceutical compounds.
Used as a Prodrug:
In drug development, (2-Allylsulfanyl-benzoimidazol-1-yl)-acetic acid can be used as a prodrug to improve the bioavailability of certain drugs. Its carboxylic acid component can be modified to enhance drug absorption, distribution, and overall efficacy, leading to better therapeutic outcomes for patients.
Overall, (2-Allylsulfanyl-benzoimidazol-1-yl)-acetic acid's unique structural features and diverse applications make it an important compound in both the chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 312754-94-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,7,5 and 4 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 312754-94:
(8*3)+(7*1)+(6*2)+(5*7)+(4*5)+(3*4)+(2*9)+(1*4)=132
132 % 10 = 2
So 312754-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O2S/c1-2-7-17-12-13-9-5-3-4-6-10(9)14(12)8-11(15)16/h2-6H,1,7-8H2,(H,15,16)/p-1
