3129-33-7 Usage
General Description
Bis(2,4-dinitrophenyl)-L-histidine is a chemical compound known for its use in biochemical research, specifically for its binding capabilities. The compound is derived from the essential amino acid L-histidine, which plays a crucial role in protein synthesis. The addition of the 2,4-dinitrophenyl groups significantly enhances the compound's capacity to bind with other substances, making it a valuable tool in the study of protein structure and function. Its interactions can offer insights into the molecular mechanisms underlying a variety of biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 3129-33-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,1,2 and 9 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3129-33:
(6*3)+(5*1)+(4*2)+(3*9)+(2*3)+(1*3)=67
67 % 10 = 7
So 3129-33-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H13N7O10/c26-18(27)14(20-13-3-1-11(22(28)29)6-16(13)24(32)33)5-10-8-21(9-19-10)15-4-2-12(23(30)31)7-17(15)25(34)35/h1-4,6-9,14,20H,5H2,(H,26,27)