312940-41-3 Usage
General Description
2-(isobutyrylamino)-4,5-dimethyl-3-thiophenecarboxylic acid is a chemical compound with the molecular formula C14H17NO3S. It is a derivative of thiophene carboxylic acid with isobutyrylamino and dimethyl substituents. 2-(isobutyrylamino)-4,5-dimethyl-3-thiophenecarboxylic acid has potential applications in the pharmaceutical industry, particularly in the development of new drugs and medications. Its unique structure and functional groups make it suitable for use as a building block in organic synthesis. Additionally, its properties and reactivity make it a valuable target for research in medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 312940-41-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,2,9,4 and 0 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 312940-41:
(8*3)+(7*1)+(6*2)+(5*9)+(4*4)+(3*0)+(2*4)+(1*1)=113
113 % 10 = 3
So 312940-41-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3S/c1-5(2)9(13)12-10-8(11(14)15)6(3)7(4)16-10/h5H,1-4H3,(H,12,13)(H,14,15)
