313545-47-0 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLORO-4-ISOPROPROXYPHENYLBORONIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-CHLORO-4-ISOPROPROXYPHENYLBORONIC ACID serves as a crucial component in the production of pesticides and other agrochemicals, contributing to the development of effective solutions for crop protection.
Used in Materials Science:
2-CHLORO-4-ISOPROPROXYPHENYLBORONIC ACID is utilized in the field of materials science for the synthesis of advanced materials with specific properties, such as high thermal stability, electrical conductivity, or optical characteristics.
Used as a Catalyst:
2-CHLORO-4-ISOPROPROXYPHENYLBORONIC ACID demonstrates potential as a catalyst in various chemical reactions, enhancing the efficiency and selectivity of the processes, and contributing to the advancement of green chemistry.
Used as a Reagent:
As a reagent, 2-CHLORO-4-ISOPROPROXYPHENYLBORONIC ACID is employed in a wide range of chemical reactions, facilitating the synthesis of complex organic compounds and contributing to the discovery of novel chemical entities.
Used in Anticancer Research:
2-CHLORO-4-ISOPROPROXYPHENYLBORONIC ACID has been reported to exhibit anti-cancer activity, making it a promising candidate for further research and development in the field of oncology. Its potential applications in the creation of new cancer therapies could lead to improved treatment options for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 313545-47-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,3,5,4 and 5 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 313545-47:
(8*3)+(7*1)+(6*3)+(5*5)+(4*4)+(3*5)+(2*4)+(1*7)=120
120 % 10 = 0
So 313545-47-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BClO3/c1-6(2)14-7-3-4-8(10(12)13)9(11)5-7/h3-6,12-13H,1-2H3
