313674-97-4 Usage
General Description
PD-118057 is a molecule belonging to the class of pyridine compounds, which is known for its potential as a pharmaceutical agent. It has been studied for its ability to inhibit the growth of cancer cells and has shown promising results in preclinical studies. PD-118057 is also being investigated for its potential applications in treating other diseases and conditions, including inflammation and neurodegenerative disorders. Its mechanism of action involves targeting specific molecular pathways involved in cell proliferation and survival, making it a potentially valuable tool for the development of novel therapeutics. Further research is needed to fully understand the potential uses and limitations of PD-118057, but it represents a promising avenue for the development of new medications.
Check Digit Verification of cas no
The CAS Registry Mumber 313674-97-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,3,6,7 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 313674-97:
(8*3)+(7*1)+(6*3)+(5*6)+(4*7)+(3*4)+(2*9)+(1*7)=144
144 % 10 = 4
So 313674-97-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H17Cl2NO2/c22-18-12-9-15(13-19(18)23)6-5-14-7-10-16(11-8-14)24-20-4-2-1-3-17(20)21(25)26/h1-4,7-13,24H,5-6H2,(H,25,26)