313961-69-2 Usage
Description
2-AMINO-4-HYDROXY-6-PHENOXYPYRIMIDINE is a pyrimidine derivative with the molecular formula C11H9N3O3, featuring an amino group, a hydroxy group, and a phenoxy group attached to the pyrimidine ring. This versatile chemical compound is of interest to researchers in organic synthesis and medicinal chemistry due to its potential as a building block for new pharmaceutical drugs and as a reagent in chemical reactions.
Uses
Used in Organic Synthesis:
2-AMINO-4-HYDROXY-6-PHENOXYPYRIMIDINE is used as a building block for the creation of new organic compounds, leveraging its amino and hydroxy functional groups to participate in various chemical reactions, contributing to the development of novel molecules with specific properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-AMINO-4-HYDROXY-6-PHENOXYPYRIMIDINE is used as a precursor in the synthesis of pharmaceutical drugs. Its unique structure allows for the design of molecules with potential therapeutic applications, making it a valuable tool for drug discovery and development.
Used in Chemical Reactions as a Reagent:
2-AMINO-4-HYDROXY-6-PHENOXYPYRIMIDINE serves as a reagent in chemical reactions, facilitating the formation of desired products through its reactive functional groups. Its presence can enhance the efficiency and selectivity of reactions, making it a useful component in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 313961-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,3,9,6 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 313961-69:
(8*3)+(7*1)+(6*3)+(5*9)+(4*6)+(3*1)+(2*6)+(1*9)=142
142 % 10 = 2
So 313961-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H9N3O2/c11-10-12-8(14)6-9(13-10)15-7-4-2-1-3-5-7/h1-6H,(H3,11,12,13,14)
