314029-36-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-4-fluoro-6-phenoxypyrimidine is used as a chemical intermediate for the synthesis of various biologically active compounds and pharmaceutical agents. Its unique structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical field, 2-Amino-4-fluoro-6-phenoxypyrimidine is utilized as an intermediate in the creation of agricultural chemicals. Its properties make it suitable for the synthesis of compounds that can be used in pest control and crop protection, thereby enhancing agricultural productivity and sustainability.
Used in Chemical Research and Development:
2-Amino-4-fluoro-6-phenoxypyrimidine is employed as a subject of interest in chemical research and development. Its unique structure and properties provide a foundation for exploring new chemical reactions and mechanisms, potentially leading to the discovery of novel applications and compounds with diverse uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 314029-36-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,4,0,2 and 9 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 314029-36:
(8*3)+(7*1)+(6*4)+(5*0)+(4*2)+(3*9)+(2*3)+(1*6)=102
102 % 10 = 2
So 314029-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8FN3O/c11-8-6-9(14-10(12)13-8)15-7-4-2-1-3-5-7/h1-6H,(H2,12,13,14)
