31407-25-7 Usage
Uses
Used in Pharmaceutical Industry:
2-AMINO-3-QUINOLINECARBONITRILE is used as a key intermediate for the synthesis of various pharmaceutical compounds due to its unique chemical structure and potential biological activity. Its role in drug development is crucial, as it can be incorporated into the molecular structures of new medications to enhance their therapeutic effects.
Used in Organic Synthesis:
In the field of organic chemistry, 2-AMINO-3-QUINOLINECARBONITRILE is utilized as a building block for the creation of other organic compounds. Its presence in the synthesis process allows for the development of a wide range of chemical products, from dyes to agrochemicals, highlighting its versatility in chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 31407-25-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,4,0 and 7 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 31407-25:
(7*3)+(6*1)+(5*4)+(4*0)+(3*7)+(2*2)+(1*5)=77
77 % 10 = 7
So 31407-25-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3/c11-6-8-5-7-3-1-2-4-9(7)13-10(8)12/h1-5H,(H2,12,13)/p+1
