31430-41-8 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Amino-3-chloro-5-methylpyridine is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Production:
2-AMINO-3-CHLORO-5-METHYLPYRIDINE is also utilized in the production of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals to protect crops and enhance agricultural productivity.
Used as a Chemical Intermediate:
2-Amino-3-chloro-5-methylpyridine serves as an intermediate in the manufacture of other organic compounds, playing a vital role in the synthesis of a wide range of chemical products.
Used in Research Laboratories:
In research settings, 2-Amino-3-chloro-5-methylpyridine is employed as a reagent for various chemical reactions, facilitating scientific investigations and the discovery of new chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 31430-41-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,4,3 and 0 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 31430-41:
(7*3)+(6*1)+(5*4)+(4*3)+(3*0)+(2*4)+(1*1)=68
68 % 10 = 8
So 31430-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H7ClN2/c1-4-2-5(7)6(8)9-3-4/h2-3H,1H3,(H2,8,9)
31430-41-8Relevant academic research and scientific papers
Herbicidal pyridine compounds
-
, (2008/06/13)
Herbicidal 3- and/or 5-halogenomethyl-pyrid-2-yloxyphenoxy compounds and processes for making and using the same. Intermediates for making these compounds and their preparation are also disclosed. Thus, for example, 2-chloro-5-trichloromethylpyridine is prepared by a liquid phase chlorination of 3-methylpyridine under the influence of ultra violet light.
