31430-47-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-3,5-dichlor0-4-methylpyridine is utilized as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Amino-3,5-dichlor0-4-methylpyridine serves as an intermediate for the production of agrochemicals. Its role in this industry is crucial for the development of effective pesticides and other agricultural chemicals that protect crops and enhance agricultural productivity.
Used in Organic Synthesis:
As a building block in organic synthesis, 2-Amino-3,5-dichlor0-4-methylpyridine is employed in the creation of complex organic molecules. Its versatile structure makes it a valuable component in the synthesis of a wide range of organic compounds, including those with potential applications in various industries.
Used in Industrial Processes:
2-Amino-3,5-dichlor0-4-methylpyridine can be found in some industrial processes, where its unique properties are harnessed to achieve specific outcomes. Its presence in these processes highlights the compound's versatility and the importance of its role in various applications.
Environmental Considerations:
Due to its chemical structure and properties, 2-amino-3,5-dichlor0-4-methylpyridine is considered to be a potential environmental hazard. As such, it may require careful handling and disposal measures to prevent adverse effects on human health and the environment. Proper management of 2-AMINO-3,5-DICHLORO-4-METHYLPYRIDINE is essential to mitigate any potential risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 31430-47-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,4,3 and 0 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 31430-47:
(7*3)+(6*1)+(5*4)+(4*3)+(3*0)+(2*4)+(1*7)=74
74 % 10 = 4
So 31430-47-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H6Cl2N2/c1-3-4(7)2-10-6(9)5(3)8/h2H,1H3,(H2,9,10)
31430-47-4Relevant academic research and scientific papers
COMBINATION THERAPY WITH MDM2 AND EFGR INHIBITORS
-
Page/Page column 166, (2016/01/29)
Provided is a method of treating a proliferative disease, condition, or disorder in a subject by administering a combination of an inhibitor of p53 and MDM2 binding and an EGFR inhibitor. Various embodiments of the disclosed methods provide a synergistic
