31432-41-4 Usage
Uses
Used in Pharmaceutical Applications:
Ethanone, 1-(5-bromoselenophene-2-yl)is used as a pharmaceutical agent for its potential antioxidant, anticancer, and antimicrobial properties. The presence of the bromine atom and the selenophene ring in the molecule can contribute to its therapeutic effects, making it a valuable compound for the development of new drugs and treatments.
Used in Materials Science:
In the field of materials science, Ethanone, 1-(5-bromoselenophene-2-yl)can be utilized for its unique structural properties. Ethanone, 1-(5-bromoselenophene-2-yl)-'s organoselenium nature and the presence of the bromine atom may offer new possibilities for the design and synthesis of advanced materials with specific properties, such as improved conductivity or enhanced stability.
Used in Organic Synthesis:
Ethanone, 1-(5-bromoselenophene-2-yl)is used as a synthetic intermediate in organic synthesis. Its unique structure and functional groups can be employed in the preparation of various organic compounds, potentially leading to the discovery of new molecules with novel properties and applications.
Used in Electrochemical Applications:
The presence of the selenium atom in Ethanone, 1-(5-bromoselenophene-2-yl)provides potential for redox chemistry, making it a candidate for use in electrochemical applications. Ethanone, 1-(5-bromoselenophene-2-yl)could be explored for its potential in the development of new electrochemical devices, sensors, or energy storage systems.
Used in Catalytic Applications:
Ethanone, 1-(5-bromoselenophene-2-yl)can also be employed in catalytic applications due to its unique structure and the presence of the selenium atom. Ethanone, 1-(5-bromoselenophene-2-yl)may be used as a catalyst or a catalyst precursor in various chemical reactions, potentially improving reaction efficiency or enabling new synthetic pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 31432-41-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,4,3 and 2 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 31432-41:
(7*3)+(6*1)+(5*4)+(4*3)+(3*2)+(2*4)+(1*1)=74
74 % 10 = 4
So 31432-41-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrOSe/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3
