31432-41-4 Usage
General Description
Ethanone, 1-(5-bromoselenophene-2-yl)- is a chemical compound with the formula C8H5BrOSe. It belongs to the group of organoselenium compounds, which are known for their potential applications in pharmaceuticals, materials science, and organic synthesis. This specific compound contains a bromine atom and a selenophene ring, which can confer unique properties to the molecule. Organoselenium compounds have been studied for their antioxidant, anticancer, and antimicrobial properties, and further research on this compound could potentially unveil new applications in these fields. Additionally, the presence of the selenium atom provides potential for redox chemistry, making this compound of interest for various electrochemical and catalytic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 31432-41-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,4,3 and 2 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 31432-41:
(7*3)+(6*1)+(5*4)+(4*3)+(3*2)+(2*4)+(1*1)=74
74 % 10 = 4
So 31432-41-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrOSe/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3
