31460-32-9 Usage
Uses
Used in Pharmaceutical Synthesis:
N-(2,5-Dichlorophenyl)maleamic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of biologically active molecules. Its unique structure allows for the creation of compounds with potential therapeutic properties.
Used in Agrochemical Synthesis:
In the agrochemical industry, N-(2,5-Dichlorophenyl)maleamic acid serves as a precursor in the production of various agrochemicals, including pesticides and herbicides. Its role in these applications is to provide a foundation for the creation of compounds that can effectively control and manage pests and weeds in agricultural settings.
Used in Organic Chemistry Research:
As a versatile building block, N-(2,5-Dichlorophenyl)maleamic acid is utilized in organic chemistry research for the exploration and development of new chemical reactions and synthesis pathways. Its reactivity and structural features make it a valuable tool for advancing the understanding of organic chemistry and discovering novel compounds with potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 31460-32-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,4,6 and 0 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 31460-32:
(7*3)+(6*1)+(5*4)+(4*6)+(3*0)+(2*3)+(1*2)=79
79 % 10 = 9
So 31460-32-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H7Cl2NO3/c11-6-1-2-7(12)8(5-6)13-9(14)3-4-10(15)16/h1-5H,(H,13,14)(H,15,16)/b4-3-
