315-56-0 Usage
General Description
1-Bromo-5-fluoronaphthalene is a chemical compound consisting of a naphthalene ring with a bromine atom at the 1 position and a fluorine atom at the 5 position. It is primarily used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It is a colorless to light yellow liquid with a high boiling point, making it useful in high-temperature reactions. Its properties make it a versatile reagent in organic chemistry, allowing for the creation of diverse molecules with specific properties and functions. Additionally, 1-Bromo-5-fluoronaphthalene is known for its relatively high reactivity and selectivity in various chemical reactions, making it valuable in the development of new drug candidates and other important chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 315-56-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,1 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 315-56:
(5*3)+(4*1)+(3*5)+(2*5)+(1*6)=50
50 % 10 = 0
So 315-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H6BrF/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6H
315-56-0Relevant articles and documents
KRAS G12C INHIBITORS
-
Paragraph 0372, (2020/03/23)
The present invention relates to compounds that, inhibit KRas G12C, In particular, the present invention relates to compounds that irreversibly inhibit the activity of KRas G12C, pharmaceutical compositions comprising the compounds and methods of use therefor.
