3150-53-6 Usage
Type of compound
Nitro compound
Structural features
Contains a pyrrole ring
Contains a carbonitrile group
Contains a hydroxyethyl group
Potential applications
Organic synthesis
Medicinal chemistry
Pharmaceutical properties
Studied for anti-cancer activity
Studied for anti-inflammatory activity
Research focus
Potential use in the development of new drugs
Utility in organic chemistry
Unique structure and combination of functional groups
Potentially useful building block for the synthesis of more complex molecules
Check Digit Verification of cas no
The CAS Registry Mumber 3150-53-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,1,5 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3150-53:
(6*3)+(5*1)+(4*5)+(3*0)+(2*5)+(1*3)=56
56 % 10 = 6
So 3150-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O3/c8-5-6-1-2-7(10(12)13)9(6)3-4-11/h1-2,11H,3-4H2