31540-68-8 Usage
Uses
Used in Chemical Synthesis:
Oxalocrotonate is used as a chemical intermediate for the synthesis of various organic compounds and pharmaceuticals. Its unique structure allows for versatile reactions and functional group manipulations, making it a valuable building block in organic chemistry.
Used in Polymer Science:
In the field of polymer science, oxalocrotonate is used as a monomer for the production of polymers with specific properties. Its ability to form double bonds and participate in polymerization reactions contributes to the development of new materials with tailored characteristics.
Used in Analytical Chemistry:
Oxalocrotonate is employed as an analytical reagent in various analytical techniques, such as chromatography and spectroscopy. Its distinct chemical properties enable the detection and quantification of specific compounds in complex mixtures.
Used in Environmental Applications:
Oxalocrotonate can be utilized in environmental applications, such as the remediation of contaminated soils and water. Its ability to chelate metal ions and form stable complexes can help in the removal of heavy metals and other pollutants from the environment.
Used in Pharmaceutical Development:
In the pharmaceutical industry, oxalocrotonate is used as a starting material for the development of new drugs. Its unique structure and reactivity make it a promising candidate for the synthesis of novel therapeutic agents with potential applications in various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 31540-68-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,5,4 and 0 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 31540-68:
(7*3)+(6*1)+(5*5)+(4*4)+(3*0)+(2*6)+(1*8)=88
88 % 10 = 8
So 31540-68-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1,3H,2H2,(H,8,9)(H,10,11)/b3-1+
