31642-90-7 Usage
General Description
3-Amino-4-morpholin-4-yl-benzamide is a chemical compound with the molecular formula C12H15N3O2. 3-AMINO-4-MORPHOLIN-4-YL-BENZAMIDE is a benzamide derivative with a morpholine ring and an amino group. It is used in pharmaceutical research as a building block in the synthesis of therapeutic agents and potential drug candidates. The compound has potential pharmacological properties and may be used in the development of drugs for various medical conditions. 3-Amino-4-morpholin-4-yl-benzamide is synthesized through the reaction of 3-amino-4-chlorobenzoyl chloride with morpholine, followed by conversion to the benzamide through a substitution reaction. It has potential applications in medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 31642-90-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,6,4 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 31642-90:
(7*3)+(6*1)+(5*6)+(4*4)+(3*2)+(2*9)+(1*0)=97
97 % 10 = 7
So 31642-90-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3O2/c12-9-7-8(11(13)15)1-2-10(9)14-3-5-16-6-4-14/h1-2,7H,3-6,12H2,(H2,13,15)