31697-10-6 Usage
Description
Ethyl 3-hydrazino-5-methyl-1H-pyrazole-4-carboxylate monohydrochloride is a chemical compound with the molecular formula C9H15N5O2Cl. It is a monohydrochloride salt of ethyl 3-hydrazino-5-methyl-1H-pyrazole-4-carboxylate, which is a hydrazine derivative with potential antitumor and antimalarial properties. Its hydrochloride form makes it more stable and easier to handle in laboratory settings, making it an important intermediate in the production of various drugs and organic compounds. Its properties make it valuable in the field of medicinal chemistry and pharmaceutical development.
Uses
Used in Pharmaceutical Industry:
Ethyl 3-hydrazino-5-methyl-1H-pyrazole-4-carboxylate monohydrochloride is used as an intermediate in the synthesis of pharmaceuticals for its potential antitumor and antimalarial properties. Its stability and ease of handling in laboratory settings make it a valuable component in the development of new drugs and organic compounds.
Used in Medicinal Chemistry Research:
Ethyl 3-hydrazino-5-methyl-1H-pyrazole-4-carboxylate monohydrochloride is used as a research compound in medicinal chemistry to explore its potential applications and properties. Its unique structure and properties make it a promising candidate for further investigation and development in the field of pharmaceuticals and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 31697-10-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,6,9 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 31697-10:
(7*3)+(6*1)+(5*6)+(4*9)+(3*7)+(2*1)+(1*0)=116
116 % 10 = 6
So 31697-10-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N4O2.ClH/c1-3-13-7(12)5-4(2)10-11-6(5)9-8;/h3,8H2,1-2H3,(H2,9,10,11);1H/p-1
