3171-25-3 Usage
Uses
Used in Pharmaceutical Industry:
2,4(1H,3H)-Pyrimidinedione, 5-methyl-, 4-oxime (9CI) is used as a building block in the synthesis of various pharmaceuticals. Its unique chemical structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Agriculture Industry:
In the agriculture industry, 2,4(1H,3H)-Pyrimidinedione, 5-methyl-, 4-oxime (9CI) is used as a building block in the synthesis of agrochemicals. Its potential applications in this field include the development of new pesticides, herbicides, and other agricultural chemicals to improve crop yield and protect plants from pests and diseases.
Used in Research and Development:
2,4(1H,3H)-Pyrimidinedione, 5-methyl-, 4-oxime (9CI) is of interest for further research and development due to its potential biological activities. Its unique chemical properties and potential applications make it a subject of interest for chemical and pharmaceutical companies, as well as research institutions. Further studies on its properties and applications can lead to the discovery of new uses and advancements in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 3171-25-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,1,7 and 1 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3171-25:
(6*3)+(5*1)+(4*7)+(3*1)+(2*2)+(1*5)=63
63 % 10 = 3
So 3171-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c1-3-2-6-5(9)7-4(3)8-10/h2,10H,1H3,(H2,6,7,8,9)
