317356-85-7 Usage
Uses
Used in Pharmaceutical Industry:
4-AMINO-2,3-DIFLUOROBENZENE ACETIC ACID ETHYL ESTER is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drug molecules. Its unique chemical structure allows for the creation of compounds with specific therapeutic properties, making it valuable in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 4-AMINO-2,3-DIFLUOROBENZENE ACETIC ACID ETHYL ESTER is utilized as an intermediate in the production of pesticides. Its incorporation into these chemical formulations aids in enhancing the effectiveness of pest control agents, contributing to improved agricultural yields and crop protection.
Safety Precautions:
It is essential to handle 4-AMINO-2,3-DIFLUOROBENZENE ACETIC ACID ETHYL ESTER with appropriate safety measures, as it can pose health risks if mishandled. Proper protective equipment, such as gloves and safety goggles, should be worn during its manipulation to minimize potential exposure and ensure the safety of those working with 4-AMINO-2,3-DIFLUOROBENZENE ACETIC ACID ETHYL ESTER.
Check Digit Verification of cas no
The CAS Registry Mumber 317356-85-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,7,3,5 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 317356-85:
(8*3)+(7*1)+(6*7)+(5*3)+(4*5)+(3*6)+(2*8)+(1*5)=147
147 % 10 = 7
So 317356-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H11F2NO2/c1-2-15-8(14)5-6-3-4-7(13)10(12)9(6)11/h3-4H,2,5,13H2,1H3
