31748-44-4 Usage
Uses
Used in Pharmaceutical Industry:
1-METHYL-1H-INDAZOLE-3-CARBONITRILE is used as a key intermediate in the synthesis of various pharmaceuticals, contributing to the development of new drugs with diverse therapeutic applications. Its unique chemical structure allows for the creation of molecules with specific biological activities, making it a valuable component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 1-METHYL-1H-INDAZOLE-3-CARBONITRILE serves as a precursor in the production of pesticides and other agrochemicals. Its incorporation into these products can enhance their effectiveness in controlling pests and diseases, thereby improving crop yields and quality.
Used in Material Science:
1-METHYL-1H-INDAZOLE-3-CARBONITRILE is utilized in material science for the development of novel materials with specific properties. Its cyano group can participate in various chemical reactions, enabling the synthesis of materials with tailored characteristics for use in different applications, such as sensors, electronic devices, or advanced materials.
Used in Organic Chemistry:
As a versatile building block, 1-METHYL-1H-INDAZOLE-3-CARBONITRILE is employed in organic chemistry for the synthesis of complex organic molecules. Its reactivity and functional group make it suitable for use in various organic reactions, facilitating the creation of new compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 31748-44-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,7,4 and 8 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 31748-44:
(7*3)+(6*1)+(5*7)+(4*4)+(3*8)+(2*4)+(1*4)=114
114 % 10 = 4
So 31748-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3/c1-12-9-5-3-2-4-7(9)8(6-10)11-12/h2-5H,1H3
