31822-29-4 Usage
Chemical class
Pyrimidine derivative
Explanation
The compound belongs to the class of pyrimidine derivatives, which are heterocyclic compounds with a six-membered ring containing four carbon atoms and two nitrogen atoms.
Explanation
The compound has a complex molecular structure, featuring a carboxylic acid group, a hydroxyethyl group, and a tetrahydro ring system.
Explanation
The compound contains a carboxylic acid group (-COOH) and a hydroxyethyl group (-CH2CH2OH), which contribute to its chemical reactivity and potential applications.
Explanation
Due to its potential biological and pharmacological properties, the compound is often used in the field of medicinal chemistry for drug development and the design of novel antiviral or antimicrobial agents.
Explanation
The compound's structural features make it a valuable building block for the synthesis of more complex organic molecules with potential therapeutic benefits.
Explanation
Additional research and investigation into the properties and potential uses of 1,2,3,6-tetrahydro-1-(2-hydroxyethyl)-2,6-dioxopyrimidine-4-carboxylic acid are necessary to fully understand its capabilities and applications in various fields.
Explanation
The solubility of the compound in different solvents is not mentioned in the provided material, and further research would be needed to determine this property.
Explanation
The stability of the compound under various conditions, such as temperature, pH, or in the presence of other chemicals, is not mentioned in the provided material and would require further investigation.
Molecular structure
Complex
Functional groups
Carboxylic acid and hydroxyethyl
Applications
Medicinal chemistry
Synthesis
Building block for complex organic molecules
Further research
Warranted
Solubility
Unknown (based on provided material)
Stability
Unknown (based on provided material)
Check Digit Verification of cas no
The CAS Registry Mumber 31822-29-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,8,2 and 2 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 31822-29:
(7*3)+(6*1)+(5*8)+(4*2)+(3*2)+(2*2)+(1*9)=94
94 % 10 = 4
So 31822-29-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O5/c10-2-1-9-5(11)3-4(6(12)13)8-7(9)14/h3,10H,1-2H2,(H,8,14)(H,12,13)
