318280-69-2 Usage
Uses
Used in Pharmaceutical Industry:
N-CHLOROACETYLISONIPECOTIC ACID is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of new drugs with potential therapeutic applications, making it an essential component in the development of novel medications.
Used in Organic Synthesis:
In the realm of organic synthesis, N-CHLOROACETYLISONIPECOTIC ACID is used as a versatile building block for the creation of a wide range of chemical compounds. Its functional groups enable various chemical reactions, facilitating the synthesis of complex molecules with diverse applications in industries such as pharmaceuticals, agrochemicals, and materials science.
Used in Research and Development:
N-CHLOROACETYLISONIPECOTIC ACID is also utilized in research and development settings, where it serves as a valuable tool for exploring new chemical reactions and understanding the properties of related compounds. Its unique structure and reactivity make it an attractive candidate for studying the mechanisms of organic reactions and developing new synthetic methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 318280-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,8,2,8 and 0 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 318280-69:
(8*3)+(7*1)+(6*8)+(5*2)+(4*8)+(3*0)+(2*6)+(1*9)=142
142 % 10 = 2
So 318280-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H12ClNO3/c9-5-7(11)10-3-1-6(2-4-10)8(12)13/h6H,1-5H2,(H,12,13)
318280-69-2Relevant academic research and scientific papers
Streptogramin derivatives, their preparation and compositions containing them
-
, (2008/06/13)
Group A streptogramin derivatives of general formula (I) in which:R1 represents a halogen atom or an azido or thiocyanato radical,R2 represents a hydrogen atom or a methyl or ethyl radical,R3 represents a hydrogen atom, or the residue of an aliphatic, cycloaliphatic, aromatic, araliphatic, heterocyclic or heterocyclylaliphatic ester which may be substituted, andthe bond - - -represents a single bond (stereochemistry 27R) or a double bond,as well as its salts when they exist.
