31872-78-3 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-4-methoxypyridin-3-amine is used as a key intermediate in the synthesis of various pharmaceuticals for its unique reactivity and properties. It contributes to the development of new drugs by facilitating the creation of diverse chemical structures that can target specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Bromo-4-methoxypyridin-3-amine is utilized as a building block for the synthesis of pesticides and other agrochemicals. Its unique chemical structure allows for the design of compounds with targeted effects on pests or weeds, enhancing crop protection and yield.
Used in Medicinal Chemistry Research:
5-Bromo-4-methoxypyridin-3-amine serves as an important compound in medicinal chemistry research, where it is employed for exploring new chemical entities and optimizing drug candidates. Its presence in various synthetic pathways enables the discovery of potential therapeutic agents with improved efficacy and selectivity.
Used in Chemical Compound Development:
As a pyridine derivative with distinct functional groups, 5-Bromo-4-methoxypyridin-3-amine is used in the development of new chemical compounds with specific applications. Its reactivity and structural features make it a promising candidate for creating innovative materials and compounds in various fields, including but not limited to pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 31872-78-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,8,7 and 2 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 31872-78:
(7*3)+(6*1)+(5*8)+(4*7)+(3*2)+(2*7)+(1*8)=123
123 % 10 = 3
So 31872-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BrN2O/c1-10-6-4(7)2-9-3-5(6)8/h2-3H,8H2,1H3
