319457-34-6 Usage
General Description
2-Acetyl-3,6-difluorobenzoic acid is a chemical compound with the molecular formula C10H7F2O3. It is a fluorinated derivative of benzoic acid and contains two fluorine atoms in its structure. 2-ACETYL-3,6-DIFLUOROBENZOIC ACID is used in the synthesis of various pharmaceuticals and agrochemicals. It has potential applications in the field of medicinal chemistry due to its unique structure and properties. Additionally, it can also be used as an intermediate in the production of other organic compounds. The acetyl group in the chemical structure may provide additional reactivity and functionality, making it a valuable building block for the synthesis of more complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 319457-34-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,1,9,4,5 and 7 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 319457-34:
(8*3)+(7*1)+(6*9)+(5*4)+(4*5)+(3*7)+(2*3)+(1*4)=156
156 % 10 = 6
So 319457-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H6F2O3/c1-4(12)7-5(10)2-3-6(11)8(7)9(13)14/h2-3H,1H3,(H,13,14)
