3201-98-7 Usage
Uses
Used in Pharmaceutical Industry:
α-Benzyl-N-methylfuran-2-methanamine is used as a potential pharmaceutical agent for its structural features that may exhibit pharmacological properties. Its furan ring and attached functional groups could be leveraged in the development of new drugs, particularly in the areas of medicinal chemistry and drug discovery.
Used in Organic Synthesis:
In the field of organic synthesis, α-Benzyl-N-methylfuran-2-methanamine is used as a building block for creating more complex molecular structures. Its unique combination of a furan ring with various substituents makes it a versatile component in the synthesis of novel compounds with potential applications in various industries, including materials science, agrochemicals, and specialty chemicals.
Further investigation is necessary to fully understand the properties and potential uses of α-Benzyl-N-methylfuran-2-methanamine, as its diverse practical applications are still being explored.
Check Digit Verification of cas no
The CAS Registry Mumber 3201-98-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,0 and 1 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3201-98:
(6*3)+(5*2)+(4*0)+(3*1)+(2*9)+(1*8)=57
57 % 10 = 7
So 3201-98-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO/c1-14-12(13-8-5-9-15-13)10-11-6-3-2-4-7-11/h2-9,12,14H,10H2,1H3
