3202-34-4

Usage

Uses

Used in Medicinal Chemistry:
4-(4-FLUORO-PHENOXY)-PIPERIDINE HYDROCHLORIDE is used as a chemical intermediate for the synthesis of various pharmaceutical compounds due to its unique structural features that may confer specific biological activities.
Used in Drug Development:
In the pharmaceutical industry, 4-(4-FLUORO-PHENOXY)-PIPERIDINE HYDROCHLORIDE is utilized as a precursor in the development of new drugs, potentially targeting a range of therapeutic areas based on its chemical properties and the ability to modify its structure to enhance or direct its pharmacological effects.
Used in Research and Development:
4-(4-FLUORO-PHENOXY)-PIPERIDINE HYDROCHLORIDE serves as a subject of study in research laboratories, where scientists investigate its interactions with biological targets, such as receptors, enzymes, or ion channels, to understand its potential therapeutic applications and optimize its pharmacological profile.

InChI:InChI=1S/C11H14FNO.ClH/c12-9-1-3-10(4-2-9)14-11-5-7-13-8-6-11;/h1-4,11,13H,5-8H2;1H

Relevant academic research and scientific papers

AMINE DERIVATIVES

A compound of the formula: ???whereinX and X' are the same or different, and each represents a hydrogen atom, a fluorine atom, a chlorine atom or an amino optionally having substituents, and at least one of X and X' represents a fluorine atom, a chlorine atom or an amino optionally having substituents;R1 and R2 represent a hydrogen atom or C1-6 alkyl optionally having substituents, or R1 and R2, together with the adjacent nitrogen atom, form a nitrogen-containing heterocyclic ring optionally having substituents;Y and Q are the same or different, and each represents a bond or a spacer having a main chain of 1 to 6 atoms;... represents a single bond or a double bond;T1 and T2 are the same or different, and each represents C(R9) (R9 represents a hydrogen atom, a hydroxy or C1-6 alkyl) or N, when each of the adjacent ... is a single bond, and C when the adjacent ... is a double bond; andAr represents an aromatic group optionally having substituents, a C3-9 cycloalkyl group optionally having substituents, a 3 to 9-membered saturated heterocyclic group optionally having substituents, a hydrogen atom or a halogen atom; provided that 6-chloro-3-(R,S)-(N,N-dimethylamino)methyl-1-[3-(indol-3-yl)-2-[(R)-(4-phenylpiperazin-1-yl)carbonylamino]propanoyl]-1,2,3,4-tetrahydroquinoline; 6-chloro-3-(R,S)-(N,N-dimethylamino)methyl-1-[3-(indol-3-yl)-2-[(R)-4-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)piperidinocarbonylamino]propanoyl]-1,2,3,4-tetrahydroquinoline and 1-benzoyl-N-[(R)-2-[6-chloro-3-[(N,N-dimethylamino)methyl]-1,2,3,4-tetrahydroquinolin-1-yl]-1-[3-(indol-3-yl)propanoyl]-4-piperidinecarboxamide are excluded; a salt thereof or a prodrug thereof has an excellent somatostatin receptor binding inhibition action and is useful for preventing and/or treating diseases associated with somatostatin.

Arylthio piperidinamide of (4-quinolinylamino)benzoic acid and S-oxidized derivatives

This invention provides a piperidine compound of the formula: STR1 wherein R1 is hydrogen or trihalomethyl, R2 is hydrogen or protected carboxy, R3 is heterocyclic group or aryl which may be halogen substituted, and X is -