32048-19-4 Usage
Uses
Used in Organic Synthesis:
2,4-DIMETHOXY-BENZAMIDINE is utilized as a reagent in organic synthesis for the preparation of a variety of pharmaceuticals and organic compounds. Its unique structure allows it to participate in numerous chemical reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
As a building block, 2,4-DIMETHOXY-BENZAMIDINE is employed in the synthesis of heterocyclic compounds, which are often found in biologically active molecules. Its role in creating these compounds contributes to the development of new pharmaceutical agents.
Used in Biological Activity Studies:
2,4-DIMETHOXY-BENZAMIDINE has been investigated for its potential biological activities, such as its ability to inhibit certain enzymes. This property makes it a candidate for further research into its use as a drug for treating various diseases, highlighting its potential as a therapeutic agent.
Used in Drug Development:
Given its potential as a drug candidate, 2,4-DIMETHOXY-BENZAMIDINE is explored in drug development for its possible application in treating specific conditions. Its versatility and importance in organic chemistry and pharmaceutical research make it a promising compound for future medicinal applications.
Check Digit Verification of cas no
The CAS Registry Mumber 32048-19-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,0,4 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 32048-19:
(7*3)+(6*2)+(5*0)+(4*4)+(3*8)+(2*1)+(1*9)=84
84 % 10 = 4
So 32048-19-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3,(H3,10,11)
