320740-35-0 Usage
Uses
Used in Pharmaceutical Research and Organic Synthesis:
2-Amino-3-bromo-4-methylbenzoic acid is used as a building block for the development of new compounds due to its unique structure and potential biological activity. It serves as an important intermediate in the synthesis of various pharmaceuticals and agrochemicals, contributing to the creation of novel drugs and bioactive compounds.
Used in the Production of Pharmaceuticals and Agrochemicals:
In the pharmaceutical industry, 2-Amino-3-bromo-4-methylbenzoic acid is utilized as a key intermediate in the manufacturing process of various drugs. Its presence in the molecular structure of these compounds can enhance their therapeutic effects and medicinal properties.
Used in Organic and Medicinal Chemistry for the Preparation of Heterocyclic Compounds:
2-Amino-3-bromo-4-methylbenzoic acid is employed as a precursor in the synthesis of heterocyclic compounds with potential biological activity. Its versatile structure allows for further modification and functionalization, leading to the development of compounds with diverse applications in the field of organic and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 320740-35-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,0,7,4 and 0 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 320740-35:
(8*3)+(7*2)+(6*0)+(5*7)+(4*4)+(3*0)+(2*3)+(1*5)=100
100 % 10 = 0
So 320740-35-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrNO2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,10H2,1H3,(H,11,12)
