320740-71-4 Usage
Description
2-AMINO-BENZOTHIAZOLE-6-CARBOXYLIC ACID SEC-BUTYLAMIDE, also known as 2-Aminobenzothiazole-6-carboxylic Acid sec-Butylamide (CAS# 320740-71-4), is a chemical compound with a unique molecular structure that has been identified for its potential applications in various fields. It is characterized by its ability to interact with specific biological targets, making it a promising candidate for the development of new therapeutic agents and diagnostic tools.
Uses
Used in Pharmaceutical Industry:
2-AMINO-BENZOTHIAZOLE-6-CARBOXYLIC ACID SEC-BUTYLAMIDE is used as a chemical probe for identifying tuberculosis small molecular inhibitors. Its unique molecular structure allows it to target and interact with specific proteins or enzymes involved in the development and progression of tuberculosis, providing a valuable tool for the discovery and optimization of new antitubercular drugs.
In addition to its application in the pharmaceutical industry, 2-AMINO-BENZOTHIAZOLE-6-CARBOXYLIC ACID SEC-BUTYLAMIDE may also have potential uses in other industries, such as:
1. Used in Research and Development:
2-AMINO-BENZOTHIAZOLE-6-CARBOXYLIC ACID SEC-BUTYLAMIDE can be employed as a research tool for studying the molecular mechanisms underlying tuberculosis and other related diseases. Its ability to target specific biological pathways makes it a valuable asset for understanding the complex interactions between pathogens and their hosts.
2. Used in Diagnostic Applications:
2-AMINO-BENZOTHIAZOLE-6-CARBOXYLIC ACID SEC-BUTYLAMIDE may also be utilized in the development of diagnostic tests for tuberculosis, as its interaction with specific biological targets can be exploited to detect the presence of the disease in patients. This could lead to the creation of more accurate and sensitive diagnostic methods, ultimately improving the early detection and treatment of tuberculosis.
3. Used in Drug Delivery Systems:
Similar to gallotannin, 2-AMINO-BENZOTHIAZOLE-6-CARBOXYLIC ACID SEC-BUTYLAMIDE could potentially be incorporated into novel drug delivery systems to enhance its therapeutic efficacy and bioavailability. By employing various organic and metallic nanoparticles as carriers, the compound's delivery to target cells and tissues can be improved, leading to more effective treatments for tuberculosis and other related diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 320740-71-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,0,7,4 and 0 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 320740-71:
(8*3)+(7*2)+(6*0)+(5*7)+(4*4)+(3*0)+(2*7)+(1*1)=104
104 % 10 = 4
So 320740-71-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3OS/c1-3-7(2)14-11(16)8-4-5-9-10(6-8)17-12(13)15-9/h4-7H,3H2,1-2H3,(H2,13,15)(H,14,16)/t7-/m1/s1
