3209-40-3 Usage
Uses
Used in Pharmaceutical Chemistry:
Ethyl 5-(chloromethyl)-3-isoxazolecarboxylate is used as a building block for the synthesis of various pharmaceutical compounds due to its unique structure and functional groups. The presence of the isoxazole ring, ethyl group, chloromethyl group, and carboxylate group allows for versatile chemical reactions and modifications, making it a valuable intermediate in the development of new drugs.
Used in Chemical Research:
Ethyl 5-(chloromethyl)-3-isoxazolecarboxylate is used as a research compound in advanced chemical studies. Its unique structure and properties make it an interesting subject for investigation, potentially leading to new discoveries and applications in various fields of chemistry.
Used in Material Science:
Ethyl 5-(chloromethyl)-3-isoxazolecarboxylate is used as a component in the development of new materials, such as polymers and composites, due to its potential to form stable and functional structures. Its incorporation into these materials could lead to improved properties and performance in various applications.
Used in Agrochemical Industry:
Ethyl 5-(chloromethyl)-3-isoxazolecarboxylate is used as a starting material or intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique structure and reactivity may contribute to the development of more effective and environmentally friendly products in this industry.
Check Digit Verification of cas no
The CAS Registry Mumber 3209-40-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,2,0 and 9 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3209-40:
(6*3)+(5*2)+(4*0)+(3*9)+(2*4)+(1*0)=63
63 % 10 = 3
So 3209-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H8ClNO3/c1-2-11-7(10)6-3-5(4-8)12-9-6/h3H,2,4H2,1H3
3209-40-3Relevant academic research and scientific papers
Thrombin inhibitors
-
Page column 34, (2010/02/06)
Novel five-membered heterocyclic amidines, their preparation and use as competitive inhibitors of trypsin-like serine proteases, especially thrombin and kininogenases such as kallikrein. Pharmaceutical compositions which contain the compounds as active ingredients, and use of the compounds as thrombin inhibitors, anticoagulants and antiinflammatory agents.
