321309-32-4 Usage
Uses
Used in Organic Material Synthesis:
1,2,3-Benzothiadiazole-5-carbonyl chloride is used as a key building block for the synthesis of organic materials, contributing to the development of advanced materials with unique properties. Its reactivity allows for various chemical reactions, facilitating the creation of compounds with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 1,2,3-Benzothiadiazole-5-carbonyl chloride is utilized as an important intermediate in the production of drugs. Its ability to undergo diverse chemical reactions makes it a valuable component in the synthesis of pharmaceutical compounds with potential therapeutic applications.
Used in Electronics Industry:
1,2,3-Benzothiadiazole-5-carbonyl chloride also finds applications in the electronics industry, where it serves as a crucial intermediate for the development of electronic materials. Its incorporation into these materials can enhance their performance and contribute to the advancement of electronic devices and technologies.
Used in Materials Science:
In the field of materials science, 1,2,3-Benzothiadiazole-5-carbonyl chloride is employed as a significant intermediate for the synthesis of materials with specific properties. Its versatility in chemical reactions allows for the development of materials with potential applications in various areas, including coatings, adhesives, and composites.
Overall, 1,2,3-Benzothiadiazole-5-carbonyl chloride is a multifaceted chemical compound with a wide range of applications across different industries, including organic material synthesis, pharmaceuticals, electronics, and materials science. Its reactivity and ability to undergo various chemical reactions make it a valuable intermediate in the development of innovative materials and drugs with potential benefits in numerous fields.
Check Digit Verification of cas no
The CAS Registry Mumber 321309-32-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,1,3,0 and 9 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 321309-32:
(8*3)+(7*2)+(6*1)+(5*3)+(4*0)+(3*9)+(2*3)+(1*2)=94
94 % 10 = 4
So 321309-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClN2OS/c8-7(11)4-1-2-6-5(3-4)9-10-12-6/h1-3H
321309-32-4Relevant academic research and scientific papers
SOX11 INHIBITORS FOR TREATING MANTLE CELL LYMPHOMA
-
Page/Page column 145-146, (2022/01/05)
Disclosed are compounds that are chemical inhibitors of SOX11. The compounds disclosed are useful in treatment of various cancers.
