321309-35-7 Usage
General Description
"[2-(2-Thienyl)-1,3-thiazol-4-yl]methylamine" is a chemical compound known for its complex structure involving multiple heterocycles. The compound is characterized by the presence of both thienyl (a five-membered ring containing four carbon atoms and one sulfur atom) and thiazol (a type of heterocycle featuring nitrogen, sulfur, and carbon atoms) groups. The "methylamine" part denotes the presence of a methyl group (one carbon atom and three hydrogen atoms) bonded to an amine group (one nitrogen atom and two hydrogen atoms). While there's varying detail about its usage or properties in mainstream databases, this compound, like many others, could be a subject of study in the field of organic chemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 321309-35-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,1,3,0 and 9 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 321309-35:
(8*3)+(7*2)+(6*1)+(5*3)+(4*0)+(3*9)+(2*3)+(1*5)=97
97 % 10 = 7
So 321309-35-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2S2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4,9H2
