321309-35-7 Usage
Uses
Used in Organic Chemistry Research:
[2-(2-Thienyl)-1,3-thiazol-4-yl]methylamine is used as a subject of study for its complex structure and potential reactivity in various chemical reactions. Its unique arrangement of heterocycles may offer insights into new synthetic pathways and the development of novel compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, [2-(2-Thienyl)-1,3-thiazol-4-yl]methylamine is used as a potential candidate for drug development. Its heterocycle-containing structure may provide a foundation for the design of new therapeutic agents, particularly in the areas of medicinal chemistry and drug discovery. [2-(2-THIENYL)-1,3-THIAZOL-4-YL]METHYLAMINE's properties and interactions with biological targets could be explored to identify potential applications in treating various diseases or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 321309-35-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,1,3,0 and 9 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 321309-35:
(8*3)+(7*2)+(6*1)+(5*3)+(4*0)+(3*9)+(2*3)+(1*5)=97
97 % 10 = 7
So 321309-35-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2S2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4,9H2
