32133-35-0 Usage
Uses
Used in Medicinal Chemistry:
2,4-DIFLUORO-DL-PHENYLALANINE is used as a key intermediate in the synthesis of pharmaceuticals for its potential to modulate the activity of biological targets. The presence of fluorine atoms can enhance the lipophilicity, metabolic stability, and binding affinity of the resulting compounds, leading to improved drug efficacy and safety.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2,4-DIFLUORO-DL-PHENYLALANINE serves as a building block for the creation of novel drug candidates. Its unique structure allows for the development of drugs with specific therapeutic profiles, such as those targeting neurological disorders or conditions related to neurotransmitter imbalances.
Used in Research:
2,4-DIFLUORO-DL-PHENYLALANINE is utilized as a research tool for studying protein structure and function. Its incorporation into proteins can provide insights into the effects of fluorination on protein folding, stability, and interactions with other biomolecules, contributing to a deeper understanding of protein biology.
Used as a Chiral Building Block in Organic Synthesis:
In the field of organic synthesis, 2,4-DIFLUORO-DL-PHENYLALANINE is employed as a chiral building block for the construction of enantioselective compounds. Its chiral center allows for the synthesis of enantiomerically pure products, which are essential in various applications, including the development of chiral drugs with improved pharmacological properties and reduced side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 32133-35-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,3 and 3 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 32133-35:
(7*3)+(6*2)+(5*1)+(4*3)+(3*3)+(2*3)+(1*5)=70
70 % 10 = 0
So 32133-35-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9F2NO2/c10-6-2-1-5(7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14)/t8-/m0/s1
