32133-35-0 Usage
General Description
2,4-DIFLUORO-DL-PHENYLALANINE is a chemical compound that consists of two fluorine atoms attached to a phenylalanine molecule. Phenylalanine is an essential amino acid that is needed for protein synthesis and is also a precursor for the neurotransmitters dopamine, norepinephrine, and epinephrine. The addition of fluorine atoms to the phenylalanine molecule can have various effects on its properties, including altering its bioactivity and metabolic stability. 2,4-DIFLUORO-DL-PHENYLALANINE may have potential applications in medicinal chemistry for the development of pharmaceuticals or in research as a tool for studying protein structure and function. Additionally, it may also be used as a chiral building block in organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 32133-35-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,3 and 3 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 32133-35:
(7*3)+(6*2)+(5*1)+(4*3)+(3*3)+(2*3)+(1*5)=70
70 % 10 = 0
So 32133-35-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9F2NO2/c10-6-2-1-5(7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14)/t8-/m0/s1
