32133-38-3 Usage
Uses
Used in Pharmaceutical Research:
2,5-DIFLUORO-DL-PHENYLALANINE is used as a building block for the synthesis of various drug molecules, leveraging its unique properties and potential biological activities resulting from the fluorine substitution.
Used in the Production of Fluorinated Compounds:
2,5-DIFLUORO-DL-PHENYLALANINE serves as a precursor for the production of fluorinated compounds, which have applications across different fields such as medicine, agriculture, and materials science, due to the beneficial effects of fluorine substitution on the properties and reactivity of these compounds.
Used in Medicine:
In the medical field, 2,5-DIFLUORO-DL-PHENYLALANINE is utilized for the development of new pharmaceuticals, taking advantage of its unique characteristics and potential therapeutic effects.
Used in Agriculture:
2,5-DIFLUORO-DL-PHENYLALANINE is employed in the agricultural sector for the synthesis of agrochemicals, such as pesticides and herbicides, where the fluorine substitution can enhance their effectiveness and selectivity.
Used in Materials Science:
In materials science, 2,5-DIFLUORO-DL-PHENYLALANINE is used for the development of novel materials with improved properties, such as increased stability or specific interactions, due to the presence of fluorine atoms.
Check Digit Verification of cas no
The CAS Registry Mumber 32133-38-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,3 and 3 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 32133-38:
(7*3)+(6*2)+(5*1)+(4*3)+(3*3)+(2*3)+(1*8)=73
73 % 10 = 3
So 32133-38-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9F2NO2/c10-6-1-2-7(11)5(3-6)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14)
