321438-86-2 Usage
Uses
Used in Scientific Research:
2-(METHYLTHIO)-5-PYRIDINYL-BORONIC ACID is used as a chemical intermediate for the synthesis of various organic compounds and materials in scientific research. Its boronic acid component allows for the formation of new chemical bonds and the creation of a wide range of products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-(METHYLTHIO)-5-PYRIDINYL-BORONIC ACID is used as a building block for the development of new drugs and pharmaceutical compounds. Its unique chemical properties enable the design and synthesis of novel therapeutic agents with potential applications in various medical fields.
Used in Chemical Synthesis:
2-(METHYLTHIO)-5-PYRIDINYL-BORONIC ACID is utilized as a reagent in chemical synthesis processes, particularly in the formation of carbon-boron bonds. Its ability to participate in various chemical reactions makes it a valuable tool for creating new molecules and compounds with specific properties and functions.
Used in Material Science:
In material science, 2-(METHYLTHIO)-5-PYRIDINYL-BORONIC ACID is employed as a component in the development of advanced materials with unique properties. Its incorporation into materials can lead to the creation of new materials with improved performance characteristics, such as enhanced stability, reactivity, or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 321438-86-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,1,4,3 and 8 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 321438-86:
(8*3)+(7*2)+(6*1)+(5*4)+(4*3)+(3*8)+(2*8)+(1*6)=122
122 % 10 = 2
So 321438-86-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BNO2S/c1-11-6-3-2-5(4-8-6)7(9)10/h2-4,9-10H,1H3
321438-86-2Relevant academic research and scientific papers
INHIBITORS OF HISTONE DEACETYLASE
-
Page/Page column 79-80, (2010/02/14)
The invention relates to a series of compounds useful for inhibiting histone deacetylase (HDAC) enzymatic activity. The invention also provides a method for inhibiting histone descetylase in a cell using said compounds as well as a method for treating cell proliferative diseases and conditions using said HDAC inhibitors. Further, the invention provides pharmaceutical compositions comprising the HDAC inhibiting compounds and a pharmaceutically acceptable carrier.
