32150-47-3 Usage
Quinazolinone derivative
A compound based on the quinazolinone core structure This refers to the basic structure of the compound, which is derived from the parent molecule quinazolinone.
1,2,3,4-tetrahydro-3-ethyl-4-methyl substituent
A specific structural arrangement of the hydrogen and alkyl groups on the quinazolinone core This describes the particular pattern of hydrogen and alkyl groups attached to the quinazolinone ring, which influences the compound's properties and potential applications.
Heterocyclic organic compound
A compound containing a ring structure with both carbon and non-carbon atoms This indicates the general class of organic compounds to which 1,2,3,4-Tetrahydro-3-ethyl-4-methylquinazolin-2-one belongs, characterized by the presence of a ring structure with different types of atoms.
Potential pharmacological properties
Possibility of having effects on biological systems, such as anti-inflammatory, anti-tumor, and anti-viral activities This highlights the potential for the compound to be used in medicine, although its specific functions and applications are not well-documented.
Further studies needed
The need for additional research to fully understand the properties and potential applications of the compound This emphasizes that more work is required to determine the exact role and usefulness of 1,2,3,4-Tetrahydro-3-ethyl-4-methylquinazolin-2-one in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 32150-47-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,5 and 0 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 32150-47:
(7*3)+(6*2)+(5*1)+(4*5)+(3*0)+(2*4)+(1*7)=73
73 % 10 = 3
So 32150-47-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O/c1-3-13-8(2)9-6-4-5-7-10(9)12-11(13)14/h4-8H,3H2,1-2H3,(H,12,14)
