32150-73-5 Usage
General Description
1,6-Dimethyl-3-phenyl-5-(1-pyrrolidinyl)pyrimidine-2,4(1H,3H)-dione is a chemical compound with the molecular formula C17H19N3O2. It is a pyrimidine-based compound with a pyrrolidinyl group attached to the 5th carbon, and a phenyl and two methyl groups attached to the 3rd and 6th carbons, respectively. 1,6-Dimethyl-3-phenyl-5-(1-pyrrolidinyl)pyrimidine-2,4(1H,3H)-dione may have potential pharmaceutical applications due to its structure and potential biological activity. Further research is needed to determine its specific properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 32150-73-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,5 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 32150-73:
(7*3)+(6*2)+(5*1)+(4*5)+(3*0)+(2*7)+(1*3)=75
75 % 10 = 5
So 32150-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H19N3O2/c1-12-14(18-10-6-7-11-18)15(20)19(16(21)17(12)2)13-8-4-3-5-9-13/h3-5,8-9H,6-7,10-11H2,1-2H3
