32150-74-6 Usage
General Description
1,6-Dimethyl-5-morpholino-3-phenylpyrimidine-2,4(1H,3H)-dione is a chemical compound with a complex molecular structure. It consists of a pyrimidine ring with two methyl groups, a morpholine ring, and a phenyl group. 1,6-Dimethyl-5-morpholino-3-phenylpyrimidine-2,4(1H,3H)-dione is commonly used in pharmaceutical research as a potential drug candidate or as a reagent in chemical synthesis. Its molecular structure suggests that it may have biological activity, and it could potentially be used in the development of new medicines. However, more research is needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 32150-74-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,1,5 and 0 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 32150-74:
(7*3)+(6*2)+(5*1)+(4*5)+(3*0)+(2*7)+(1*4)=76
76 % 10 = 6
So 32150-74-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H19N3O3/c1-12-14(18-8-10-22-11-9-18)15(20)19(16(21)17(12)2)13-6-4-3-5-7-13/h3-7H,8-11H2,1-2H3