321890-38-4 Usage
Uses
Used in Pharmaceutical Synthesis:
N-Methyl-1-methylazetidin-3-amine is used as a reactant or intermediate in the synthesis of pharmaceuticals. Its unique chemical structure allows it to be incorporated into the development of new drugs, contributing to the advancement of medicine.
Used in Agrochemical Production:
In the agrochemical industry, N-Methyl-1-methylazetidin-3-amine is utilized as a building block for the creation of various agrochemicals. Its properties make it suitable for the development of compounds that can be used in agriculture to improve crop yield and protect plants from pests and diseases.
Used in Organic Chemistry Research:
N-Methyl-1-methylazetidin-3-amine is also employed in organic chemistry research. Its unique structure and properties make it an interesting subject for study, allowing researchers to explore new reactions and mechanisms, ultimately contributing to the broader understanding of organic chemistry.
Used as a Building Block in Organic Synthesis:
Due to its versatile chemical properties, N-Methyl-1-methylazetidin-3-amine serves as a building block in the creation of more complex molecules. It can be used to synthesize a wide range of organic compounds, making it an essential component in various chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 321890-38-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,1,8,9 and 0 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 321890-38:
(8*3)+(7*2)+(6*1)+(5*8)+(4*9)+(3*0)+(2*3)+(1*8)=134
134 % 10 = 4
So 321890-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H12N2.ClH/c1-6-5-3-7(2)4-5;/h5-6H,3-4H2,1-2H3;1H
