321946-09-2 Usage
Uses
Used in Pharmaceutical Industry:
3-Pyridazinecarboxylic acid, 6-chloro-, 1-methylethyl ester is used as a raw material for the synthesis of various biologically active molecules. Its potent biological activity and unique structure make it a valuable component in the development of new pharmaceuticals.
Used in Agrochemical Industry:
3-Pyridazinecarboxylic acid, 6-chloro-, 1-methylethyl ester is used as an intermediate in the production of insecticides and herbicides. Its chemical properties and biological activity contribute to the effectiveness of these agrochemicals in controlling pests and weeds.
Used in Organic Chemistry Research:
Due to its unique structure and chemical properties, 3-Pyridazinecarboxylic acid, 6-chloro-, 1-methylethyl ester is an important target for research in the field of organic chemistry. It provides opportunities for the exploration of new synthetic pathways and the development of novel compounds with potential applications in various industries.
Used in Medicinal Chemistry Research:
3-Pyridazinecarboxylic acid, 6-chloro-, 1-methylethyl ester is also used in medicinal chemistry research, where it serves as a key intermediate for the synthesis of new drug candidates. Its potent biological activity and versatile chemical properties make it a valuable tool for the development of innovative therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 321946-09-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,2,1,9,4 and 6 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 321946-09:
(8*3)+(7*2)+(6*1)+(5*9)+(4*4)+(3*6)+(2*0)+(1*9)=132
132 % 10 = 2
So 321946-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClN2O2.C2H6O/c6-4-2-1-3(5(9)10)7-8-4;1-3-2/h1-2H,(H,9,10);1-2H3
